C24H27F3N6OS — CID 126534859
1-methyl-4-[4-methyl-5-[3-[1-(2,4,6-trifluorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]pyridin-2-one (PubChem CID 126534859) has the molecular formula C24H27F3N6OS and a molecular weight of 504.58 g/mol. Its IUPAC name is 1-methyl-4-[4-methyl-5-[3-[1-(2,4,6-trifluorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]pyridin-2-one.
| Compound Name | 1-methyl-4-[4-methyl-5-[3-[1-(2,4,6-trifluorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]pyridin-2-one |
|---|---|
| PubChem CID | 126534859 |
| Molecular Formula | C24H27F3N6OS |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 1-methyl-4-[4-methyl-5-[3-[1-(2,4,6-trifluorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]pyridin-2-one |
| SMILES | Cn1c(SCCCN2CC3CCN(c4c(F)cc(F)cc4F)C3C2)nnc1-c1ccn(C)c(=O)c1 |
| InChI | InChI=1S/C24H27F3N6OS/c1-30-7-4-15(10-21(30)34)23-28-29-24(31(23)2)35-9-3-6-32-13-16-5-8-33(20(16)14-32)22-18(26)11-17(25)12-19(22)27/h4,7,10-12,16,20H,3,5-6,8-9,13-14H2,1-2H3 |
| InChIKey | ZRQADOCXGLFZJC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 59.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|