About 1-[2-fluoro-4-(hydroxymethyl)cyclopentyl]-1,3-diazinan-2-one
1-[2-fluoro-4-(hydroxymethyl)cyclopentyl]-1,3-diazinan-2-one (PubChem CID 126536230) has the molecular formula C10H17FN2O2
and a molecular weight of 216.26 g/mol. Its IUPAC name is 1-[2-fluoro-4-(hydroxymethyl)cyclopentyl]-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1-[2-fluoro-4-(hydroxymethyl)cyclopentyl]-1,3-diazinan-2-one |
| PubChem CID | 126536230 |
| Molecular Formula | C10H17FN2O2 |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1-[2-fluoro-4-(hydroxymethyl)cyclopentyl]-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1C1CC(CO)CC1F |
| InChI | InChI=1S/C10H17FN2O2/c11-8-4-7(6-14)5-9(8)13-3-1-2-12-10(13)15/h7-9,14H,1-6H2,(H,12,15) |
| InChIKey | LUNKVSSXGHERFJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-fluoro-4-(hydroxymethyl)cyclopentyl]-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-fluoro-4-(hydroxymethyl)cyclopentyl]-1,3-diazinan-2-one?
The IUPAC name of 1-[2-fluoro-4-(hydroxymethyl)cyclopentyl]-1,3-diazinan-2-one (CID 126536230) is 1-[2-fluoro-4-(hydroxymethyl)cyclopentyl]-1,3-diazinan-2-one.
What is the SMILES notation for 1-[2-fluoro-4-(hydroxymethyl)cyclopentyl]-1,3-diazinan-2-one?
The canonical SMILES for 1-[2-fluoro-4-(hydroxymethyl)cyclopentyl]-1,3-diazinan-2-one is O=C1NCCCN1C1CC(CO)CC1F.
What is the InChIKey of 1-[2-fluoro-4-(hydroxymethyl)cyclopentyl]-1,3-diazinan-2-one?
The InChIKey is LUNKVSSXGHERFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17FN2O2/c11-8-4-7(6-14)5-9(8)13-3-1-2-12-10(13)15/h7-9,14H,1-6H2,(H,12,15).
What are the key properties of 1-[2-fluoro-4-(hydroxymethyl)cyclopentyl]-1,3-diazinan-2-one?
1-[2-fluoro-4-(hydroxymethyl)cyclopentyl]-1,3-diazinan-2-one has a molecular weight of 216.26 g/mol, XLogP of 0.51, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-fluoro-4-(hydroxymethyl)cyclopentyl]-1,3-diazinan-2-one is sourced from PubChem (CID 126536230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).