C18H28O4P2S3 — CID 126536393
2-[[2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)sulfanylmethyl]phenyl]methylsulfanyl]-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane (PubChem CID 126536393) has the molecular formula C18H28O4P2S3 and a molecular weight of 466.57 g/mol. Its IUPAC name is 2-[[2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)sulfanylmethyl]phenyl]methylsulfanyl]-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane.
| Compound Name | 2-[[2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)sulfanylmethyl]phenyl]methylsulfanyl]-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane |
|---|---|
| PubChem CID | 126536393 |
| Molecular Formula | C18H28O4P2S3 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | 2-[[2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)sulfanylmethyl]phenyl]methylsulfanyl]-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane |
| SMILES | CC1(C)COP(SCc2ccccc2CSP2(=S)OCC(C)(C)CO2)OC1 |
| InChI | InChI=1S/C18H28O4P2S3/c1-17(2)11-19-23(20-12-17)26-9-15-7-5-6-8-16(15)10-27-24(25)21-13-18(3,4)14-22-24/h5-8H,9-14H2,1-4H3 |
| InChIKey | UIBDGVVJWQXCHL-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|