C14H23N — CID 126536422
(4E,6E)-4-propylundeca-2,4,6,9-tetraen-5-amine (PubChem CID 126536422) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (4E,6E)-4-propylundeca-2,4,6,9-tetraen-5-amine.
| Compound Name | (4E,6E)-4-propylundeca-2,4,6,9-tetraen-5-amine |
|---|---|
| PubChem CID | 126536422 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (4E,6E)-4-propylundeca-2,4,6,9-tetraen-5-amine |
| SMILES | CC=CC/C=C/C(N)=C(\C=CC)CCC |
| InChI | InChI=1S/C14H23N/c1-4-7-8-9-12-14(15)13(10-5-2)11-6-3/h4-5,7,9-10,12H,6,8,11,15H2,1-3H3/b7-4?,10-5?,12-9+,14-13- |
| InChIKey | NUHDBKZNCNARPF-ZZKXMLFDSA-N |
| XLogP | 4.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|