About 3-cyclopropyl-4-methoxy-6-methyl-1,2-dihydroquinoline
3-cyclopropyl-4-methoxy-6-methyl-1,2-dihydroquinoline (PubChem CID 126536454) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-cyclopropyl-4-methoxy-6-methyl-1,2-dihydroquinoline.
Molecular Properties
| Compound Name | 3-cyclopropyl-4-methoxy-6-methyl-1,2-dihydroquinoline |
| PubChem CID | 126536454 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 3-cyclopropyl-4-methoxy-6-methyl-1,2-dihydroquinoline |
| SMILES | COC1=C(C2CC2)CNc2ccc(C)cc21 |
| InChI | InChI=1S/C14H17NO/c1-9-3-6-13-11(7-9)14(16-2)12(8-15-13)10-4-5-10/h3,6-7,10,15H,4-5,8H2,1-2H3 |
| InChIKey | JQERNASDRULGRP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclopropyl-4-methoxy-6-methyl-1,2-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-4-methoxy-6-methyl-1,2-dihydroquinoline?
The IUPAC name of 3-cyclopropyl-4-methoxy-6-methyl-1,2-dihydroquinoline (CID 126536454) is 3-cyclopropyl-4-methoxy-6-methyl-1,2-dihydroquinoline.
What is the SMILES notation for 3-cyclopropyl-4-methoxy-6-methyl-1,2-dihydroquinoline?
The canonical SMILES for 3-cyclopropyl-4-methoxy-6-methyl-1,2-dihydroquinoline is COC1=C(C2CC2)CNc2ccc(C)cc21.
What is the InChIKey of 3-cyclopropyl-4-methoxy-6-methyl-1,2-dihydroquinoline?
The InChIKey is JQERNASDRULGRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO/c1-9-3-6-13-11(7-9)14(16-2)12(8-15-13)10-4-5-10/h3,6-7,10,15H,4-5,8H2,1-2H3.
What are the key properties of 3-cyclopropyl-4-methoxy-6-methyl-1,2-dihydroquinoline?
3-cyclopropyl-4-methoxy-6-methyl-1,2-dihydroquinoline has a molecular weight of 215.30 g/mol, XLogP of 3.19, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-4-methoxy-6-methyl-1,2-dihydroquinoline is sourced from PubChem (CID 126536454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).