C20H24F12O5 — CID 126537216
[5-[3-ethenoxy-1,1,1-trifluoro-3-methyl-2-(trifluoromethyl)butan-2-yl]oxy-3-ethyl-1,1,1-trifluoro-2-hydroxy-2-(trifluoromethyl)pentan-3-yl] 2-methylprop-2-enoate (PubChem CID 126537216) has the molecular formula C20H24F12O5 and a molecular weight of 572.38 g/mol. Its IUPAC name is [5-[3-ethenoxy-1,1,1-trifluoro-3-methyl-2-(trifluoromethyl)butan-2-yl]oxy-3-ethyl-1,1,1-trifluoro-2-hydroxy-2-(trifluoromethyl)pentan-3-yl] 2-methylprop-2-enoate.
| Compound Name | [5-[3-ethenoxy-1,1,1-trifluoro-3-methyl-2-(trifluoromethyl)butan-2-yl]oxy-3-ethyl-1,1,1-trifluoro-2-hydroxy-2-(trifluoromethyl)pentan-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 126537216 |
| Molecular Formula | C20H24F12O5 |
| Molecular Weight | 572.38 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | [5-[3-ethenoxy-1,1,1-trifluoro-3-methyl-2-(trifluoromethyl)butan-2-yl]oxy-3-ethyl-1,1,1-trifluoro-2-hydroxy-2-(trifluoromethyl)pentan-3-yl] 2-methylprop-2-enoate |
| SMILES | C=COC(C)(C)C(OCCC(CC)(OC(=O)C(=C)C)C(O)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H24F12O5/c1-7-14(37-12(33)11(3)4,15(34,17(21,22)23)18(24,25)26)9-10-36-16(19(27,28)29,20(30,31)32)13(5,6)35-8-2/h8,34H,2-3,7,9-10H2,1,4-6H3 |
| InChIKey | RLNZNCSVRUPPNC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.38 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|