About [(3Z,4Z)-3-prop-2-enylidenehepta-4,6-dienyl]hydrazine
[(3Z,4Z)-3-prop-2-enylidenehepta-4,6-dienyl]hydrazine (PubChem CID 126537948) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is [(3Z,4Z)-3-prop-2-enylidenehepta-4,6-dienyl]hydrazine.
Molecular Properties
| Compound Name | [(3Z,4Z)-3-prop-2-enylidenehepta-4,6-dienyl]hydrazine |
| PubChem CID | 126537948 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | [(3Z,4Z)-3-prop-2-enylidenehepta-4,6-dienyl]hydrazine |
| SMILES | C=C/C=C\C(=C/C=C)CCNN |
| InChI | InChI=1S/C10H16N2/c1-3-5-7-10(6-4-2)8-9-12-11/h3-7,12H,1-2,8-9,11H2/b7-5-,10-6+ |
| InChIKey | QABYNSHQJGRCPO-ZPRNNRRZSA-N |
| XLogP | 1.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z,4Z)-3-prop-2-enylidenehepta-4,6-dienyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z,4Z)-3-prop-2-enylidenehepta-4,6-dienyl]hydrazine?
The IUPAC name of [(3Z,4Z)-3-prop-2-enylidenehepta-4,6-dienyl]hydrazine (CID 126537948) is [(3Z,4Z)-3-prop-2-enylidenehepta-4,6-dienyl]hydrazine.
What is the SMILES notation for [(3Z,4Z)-3-prop-2-enylidenehepta-4,6-dienyl]hydrazine?
The canonical SMILES for [(3Z,4Z)-3-prop-2-enylidenehepta-4,6-dienyl]hydrazine is C=C/C=C\C(=C/C=C)CCNN.
What is the InChIKey of [(3Z,4Z)-3-prop-2-enylidenehepta-4,6-dienyl]hydrazine?
The InChIKey is QABYNSHQJGRCPO-ZPRNNRRZSA-N. The full InChI is InChI=1S/C10H16N2/c1-3-5-7-10(6-4-2)8-9-12-11/h3-7,12H,1-2,8-9,11H2/b7-5-,10-6+.
What are the key properties of [(3Z,4Z)-3-prop-2-enylidenehepta-4,6-dienyl]hydrazine?
[(3Z,4Z)-3-prop-2-enylidenehepta-4,6-dienyl]hydrazine has a molecular weight of 164.25 g/mol, XLogP of 1.69, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z,4Z)-3-prop-2-enylidenehepta-4,6-dienyl]hydrazine is sourced from PubChem (CID 126537948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).