About 2-chloro-3-(N,4-diethylanilino)naphthalene-1,4-dione
2-chloro-3-(N,4-diethylanilino)naphthalene-1,4-dione (PubChem CID 126538141) has the molecular formula C20H18ClNO2
and a molecular weight of 339.82 g/mol. Its IUPAC name is 2-chloro-3-(N,4-diethylanilino)naphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2-chloro-3-(N,4-diethylanilino)naphthalene-1,4-dione |
| PubChem CID | 126538141 |
| Molecular Formula | C20H18ClNO2 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 2-chloro-3-(N,4-diethylanilino)naphthalene-1,4-dione |
| SMILES | CCc1ccc(N(CC)C2=C(Cl)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H18ClNO2/c1-3-13-9-11-14(12-10-13)22(4-2)18-17(21)19(23)15-7-5-6-8-16(15)20(18)24/h5-12H,3-4H2,1-2H3 |
| InChIKey | DNPJIQIGJSYFLK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-(N,4-diethylanilino)naphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-(N,4-diethylanilino)naphthalene-1,4-dione?
The IUPAC name of 2-chloro-3-(N,4-diethylanilino)naphthalene-1,4-dione (CID 126538141) is 2-chloro-3-(N,4-diethylanilino)naphthalene-1,4-dione.
What is the SMILES notation for 2-chloro-3-(N,4-diethylanilino)naphthalene-1,4-dione?
The canonical SMILES for 2-chloro-3-(N,4-diethylanilino)naphthalene-1,4-dione is CCc1ccc(N(CC)C2=C(Cl)C(=O)c3ccccc3C2=O)cc1.
What is the InChIKey of 2-chloro-3-(N,4-diethylanilino)naphthalene-1,4-dione?
The InChIKey is DNPJIQIGJSYFLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18ClNO2/c1-3-13-9-11-14(12-10-13)22(4-2)18-17(21)19(23)15-7-5-6-8-16(15)20(18)24/h5-12H,3-4H2,1-2H3.
What are the key properties of 2-chloro-3-(N,4-diethylanilino)naphthalene-1,4-dione?
2-chloro-3-(N,4-diethylanilino)naphthalene-1,4-dione has a molecular weight of 339.82 g/mol, XLogP of 4.60, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-(N,4-diethylanilino)naphthalene-1,4-dione is sourced from PubChem (CID 126538141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).