C16H35N3 — CID 126538746
1-N-methyl-6-N-(2-methylheptan-3-yl)hept-6-ene-1,5,6-triamine (PubChem CID 126538746) has the molecular formula C16H35N3 and a molecular weight of 269.48 g/mol. Its IUPAC name is 1-N-methyl-6-N-(2-methylheptan-3-yl)hept-6-ene-1,5,6-triamine.
| Compound Name | 1-N-methyl-6-N-(2-methylheptan-3-yl)hept-6-ene-1,5,6-triamine |
|---|---|
| PubChem CID | 126538746 |
| Molecular Formula | C16H35N3 |
| Molecular Weight | 269.48 g/mol |
| Exact Mass | 269.28 |
| IUPAC Name | 1-N-methyl-6-N-(2-methylheptan-3-yl)hept-6-ene-1,5,6-triamine |
| SMILES | C=C(NC(CCCC)C(C)C)C(N)CCCCNC |
| InChI | InChI=1S/C16H35N3/c1-6-7-11-16(13(2)3)19-14(4)15(17)10-8-9-12-18-5/h13,15-16,18-19H,4,6-12,17H2,1-3,5H3 |
| InChIKey | JZEQXJBWMIMENM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|