C20H31N5O — CID 126539207
6-[[4-[4-(2-methylpropyl)piperazin-1-yl]oxan-4-yl]methylamino]pyridine-2-carbonitrile (PubChem CID 126539207) has the molecular formula C20H31N5O and a molecular weight of 357.50 g/mol. Its IUPAC name is 6-[[4-[4-(2-methylpropyl)piperazin-1-yl]oxan-4-yl]methylamino]pyridine-2-carbonitrile.
| Compound Name | 6-[[4-[4-(2-methylpropyl)piperazin-1-yl]oxan-4-yl]methylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 126539207 |
| Molecular Formula | C20H31N5O |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | 6-[[4-[4-(2-methylpropyl)piperazin-1-yl]oxan-4-yl]methylamino]pyridine-2-carbonitrile |
| SMILES | CC(C)CN1CCN(C2(CNc3cccc(C#N)n3)CCOCC2)CC1 |
| InChI | InChI=1S/C20H31N5O/c1-17(2)15-24-8-10-25(11-9-24)20(6-12-26-13-7-20)16-22-19-5-3-4-18(14-21)23-19/h3-5,17H,6-13,15-16H2,1-2H3,(H,22,23) |
| InChIKey | KIYOSODNQKIDMZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 64.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |