C21H17F4N — CID 126539551
1-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]propan-1-amine (PubChem CID 126539551) has the molecular formula C21H17F4N and a molecular weight of 359.37 g/mol. Its IUPAC name is 1-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]propan-1-amine.
| Compound Name | 1-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]propan-1-amine |
|---|---|
| PubChem CID | 126539551 |
| Molecular Formula | C21H17F4N |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 1-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]propan-1-amine |
| SMILES | CCC(N)c1ccc(-c2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C21H17F4N/c1-2-20(26)13-5-3-12(4-6-13)14-7-8-16(17(22)9-14)15-10-18(23)21(25)19(24)11-15/h3-11,20H,2,26H2,1H3 |
| InChIKey | XMEZEDVHJUAOKX-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|