About 1-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]propan-1-amine
1-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]propan-1-amine (PubChem CID 126539551) has the molecular formula C21H17F4N
and a molecular weight of 359.37 g/mol. Its IUPAC name is 1-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]propan-1-amine.
Molecular Properties
| Compound Name | 1-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]propan-1-amine |
| PubChem CID | 126539551 |
| Molecular Formula | C21H17F4N |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 1-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]propan-1-amine |
| SMILES | CCC(N)c1ccc(-c2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C21H17F4N/c1-2-20(26)13-5-3-12(4-6-13)14-7-8-16(17(22)9-14)15-10-18(23)21(25)19(24)11-15/h3-11,20H,2,26H2,1H3 |
| InChIKey | XMEZEDVHJUAOKX-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]propan-1-amine?
The IUPAC name of 1-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]propan-1-amine (CID 126539551) is 1-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]propan-1-amine.
What is the SMILES notation for 1-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]propan-1-amine?
The canonical SMILES for 1-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]propan-1-amine is CCC(N)c1ccc(-c2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)cc1.
What is the InChIKey of 1-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]propan-1-amine?
The InChIKey is XMEZEDVHJUAOKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17F4N/c1-2-20(26)13-5-3-12(4-6-13)14-7-8-16(17(22)9-14)15-10-18(23)21(25)19(24)11-15/h3-11,20H,2,26H2,1H3.
What are the key properties of 1-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]propan-1-amine?
1-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]propan-1-amine has a molecular weight of 359.37 g/mol, XLogP of 5.99, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]phenyl]propan-1-amine is sourced from PubChem (CID 126539551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).