About 1-chloro-2,3-dimethoxypropane
1-chloro-2,3-dimethoxypropane (PubChem CID 12653960) has the molecular formula C5H11ClO2
and a molecular weight of 138.59 g/mol. Its IUPAC name is 1-chloro-2,3-dimethoxypropane.
Molecular Properties
| Compound Name | 1-chloro-2,3-dimethoxypropane |
| PubChem CID | 12653960 |
| Molecular Formula | C5H11ClO2 |
| Molecular Weight | 138.59 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 1-chloro-2,3-dimethoxypropane |
| SMILES | COCC(CCl)OC |
| InChI | InChI=1S/C5H11ClO2/c1-7-4-5(3-6)8-2/h5H,3-4H2,1-2H3 |
| InChIKey | HIMFSRCPPSYJSR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.59 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2,3-dimethoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2,3-dimethoxypropane?
The IUPAC name of 1-chloro-2,3-dimethoxypropane (CID 12653960) is 1-chloro-2,3-dimethoxypropane.
What is the SMILES notation for 1-chloro-2,3-dimethoxypropane?
The canonical SMILES for 1-chloro-2,3-dimethoxypropane is COCC(CCl)OC.
What is the InChIKey of 1-chloro-2,3-dimethoxypropane?
The InChIKey is HIMFSRCPPSYJSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11ClO2/c1-7-4-5(3-6)8-2/h5H,3-4H2,1-2H3.
What are the key properties of 1-chloro-2,3-dimethoxypropane?
1-chloro-2,3-dimethoxypropane has a molecular weight of 138.59 g/mol, XLogP of 0.89, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2,3-dimethoxypropane is sourced from PubChem (CID 12653960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).