About 1-(3-methoxypropyl)-4,4-dimethylpiperidine
1-(3-methoxypropyl)-4,4-dimethylpiperidine (PubChem CID 126539816) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-4,4-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-(3-methoxypropyl)-4,4-dimethylpiperidine |
| PubChem CID | 126539816 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 1-(3-methoxypropyl)-4,4-dimethylpiperidine |
| SMILES | COCCCN1CCC(C)(C)CC1 |
| InChI | InChI=1S/C11H23NO/c1-11(2)5-8-12(9-6-11)7-4-10-13-3/h4-10H2,1-3H3 |
| InChIKey | WBFQZBXPSRQSFC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methoxypropyl)-4,4-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methoxypropyl)-4,4-dimethylpiperidine?
The IUPAC name of 1-(3-methoxypropyl)-4,4-dimethylpiperidine (CID 126539816) is 1-(3-methoxypropyl)-4,4-dimethylpiperidine.
What is the SMILES notation for 1-(3-methoxypropyl)-4,4-dimethylpiperidine?
The canonical SMILES for 1-(3-methoxypropyl)-4,4-dimethylpiperidine is COCCCN1CCC(C)(C)CC1.
What is the InChIKey of 1-(3-methoxypropyl)-4,4-dimethylpiperidine?
The InChIKey is WBFQZBXPSRQSFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO/c1-11(2)5-8-12(9-6-11)7-4-10-13-3/h4-10H2,1-3H3.
What are the key properties of 1-(3-methoxypropyl)-4,4-dimethylpiperidine?
1-(3-methoxypropyl)-4,4-dimethylpiperidine has a molecular weight of 185.31 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methoxypropyl)-4,4-dimethylpiperidine is sourced from PubChem (CID 126539816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).