C8H15N5O — CID 12654
2-N,4-N-diethyl-6-methoxy-1,3,5-triazine-2,4-diamine (PubChem CID 12654) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-N,4-N-diethyl-6-methoxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-diethyl-6-methoxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 12654 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 2-N,4-N-diethyl-6-methoxy-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(NCC)nc(OC)n1 |
| InChI | InChI=1S/C8H15N5O/c1-4-9-6-11-7(10-5-2)13-8(12-6)14-3/h4-5H2,1-3H3,(H2,9,10,11,12,13) |
| InChIKey | HKAMKLBXTLTVCN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |