C30H37N3O — CID 126540097
2-[2-tert-butyl-6-[(E)-2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7-dien-7-yl)ethenyl]pyran-4-ylidene]propanedinitrile (PubChem CID 126540097) has the molecular formula C30H37N3O and a molecular weight of 455.65 g/mol. Its IUPAC name is 2-[2-tert-butyl-6-[(E)-2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7-dien-7-yl)ethenyl]pyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2-tert-butyl-6-[(E)-2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7-dien-7-yl)ethenyl]pyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 126540097 |
| Molecular Formula | C30H37N3O |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | 2-[2-tert-butyl-6-[(E)-2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7-dien-7-yl)ethenyl]pyran-4-ylidene]propanedinitrile |
| SMILES | CC(C)(C)C1=CC(=C(C#N)C#N)C=C(/C=C/C2=CC3C4C(=C2)C(C)(C)CCN4CCC3(C)C)O1 |
| InChI | InChI=1S/C30H37N3O/c1-28(2,3)26-17-21(22(18-31)19-32)16-23(34-26)9-8-20-14-24-27-25(15-20)30(6,7)11-13-33(27)12-10-29(24,4)5/h8-9,14-17,24,27H,10-13H2,1-7H3/b9-8+ |
| InChIKey | BLMQSGJPFBHUFB-CMDGGOBGSA-N |
| XLogP | 6.74 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|