C43H30F8O2 — CID 126540643
4-[4-[7-[4-(4-hydroxyphenyl)phenyl]-9,9-bis(1,1,2,2-tetrafluoropropyl)fluoren-2-yl]phenyl]phenol (PubChem CID 126540643) has the molecular formula C43H30F8O2 and a molecular weight of 730.70 g/mol. Its IUPAC name is 4-[4-[7-[4-(4-hydroxyphenyl)phenyl]-9,9-bis(1,1,2,2-tetrafluoropropyl)fluoren-2-yl]phenyl]phenol.
| Compound Name | 4-[4-[7-[4-(4-hydroxyphenyl)phenyl]-9,9-bis(1,1,2,2-tetrafluoropropyl)fluoren-2-yl]phenyl]phenol |
|---|---|
| PubChem CID | 126540643 |
| Molecular Formula | C43H30F8O2 |
| Molecular Weight | 730.70 g/mol |
| Exact Mass | 730.21 |
| IUPAC Name | 4-[4-[7-[4-(4-hydroxyphenyl)phenyl]-9,9-bis(1,1,2,2-tetrafluoropropyl)fluoren-2-yl]phenyl]phenol |
| SMILES | CC(F)(F)C(F)(F)C1(C(F)(F)C(C)(F)F)c2cc(-c3ccc(-c4ccc(O)cc4)cc3)ccc2-c2ccc(-c3ccc(-c4ccc(O)cc4)cc3)cc21 |
| InChI | InChI=1S/C43H30F8O2/c1-39(44,45)42(48,49)41(43(50,51)40(2,46)47)37-23-31(29-7-3-25(4-8-29)27-11-17-33(52)18-12-27)15-21-35(37)36-22-16-32(24-38(36)41)30-9-5-26(6-10-30)28-13-19-34(53)20-14-28/h3-24,52-53H,1-2H3 |
| InChIKey | XVGYOBQYQAZWQG-UHFFFAOYSA-N |
| XLogP | 12.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.70 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|