C14H16O8 — CID 12654093
1-[(3,5-dimethoxyphenyl)methyl]ethane-1,1,2-tricarboxylic acid (PubChem CID 12654093) has the molecular formula C14H16O8 and a molecular weight of 312.27 g/mol. Its IUPAC name is 1-[(3,5-dimethoxyphenyl)methyl]ethane-1,1,2-tricarboxylic acid.
| Compound Name | 1-[(3,5-dimethoxyphenyl)methyl]ethane-1,1,2-tricarboxylic acid |
|---|---|
| PubChem CID | 12654093 |
| Molecular Formula | C14H16O8 |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1-[(3,5-dimethoxyphenyl)methyl]ethane-1,1,2-tricarboxylic acid |
| SMILES | COc1cc(CC(CC(=O)O)(C(=O)O)C(=O)O)cc(OC)c1 |
| InChI | InChI=1S/C14H16O8/c1-21-9-3-8(4-10(5-9)22-2)6-14(12(17)18,13(19)20)7-11(15)16/h3-5H,6-7H2,1-2H3,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | LMXVPFHJFZFZEJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|