C44H32F8O2 — CID 126540986
4-[4-[7-[4-(4-methoxyphenyl)phenyl]-9,9-bis(1,1,2,2-tetrafluoropropyl)fluoren-2-yl]phenyl]phenol (PubChem CID 126540986) has the molecular formula C44H32F8O2 and a molecular weight of 744.72 g/mol. Its IUPAC name is 4-[4-[7-[4-(4-methoxyphenyl)phenyl]-9,9-bis(1,1,2,2-tetrafluoropropyl)fluoren-2-yl]phenyl]phenol.
| Compound Name | 4-[4-[7-[4-(4-methoxyphenyl)phenyl]-9,9-bis(1,1,2,2-tetrafluoropropyl)fluoren-2-yl]phenyl]phenol |
|---|---|
| PubChem CID | 126540986 |
| Molecular Formula | C44H32F8O2 |
| Molecular Weight | 744.72 g/mol |
| Exact Mass | 744.23 |
| IUPAC Name | 4-[4-[7-[4-(4-methoxyphenyl)phenyl]-9,9-bis(1,1,2,2-tetrafluoropropyl)fluoren-2-yl]phenyl]phenol |
| SMILES | COc1ccc(-c2ccc(-c3ccc4c(c3)C(C(F)(F)C(C)(F)F)(C(F)(F)C(C)(F)F)c3cc(-c5ccc(-c6ccc(O)cc6)cc5)ccc3-4)cc2)cc1 |
| InChI | InChI=1S/C44H32F8O2/c1-40(45,46)43(49,50)42(44(51,52)41(2,47)48)38-24-32(30-8-4-26(5-9-30)28-12-18-34(53)19-13-28)16-22-36(38)37-23-17-33(25-39(37)42)31-10-6-27(7-11-31)29-14-20-35(54-3)21-15-29/h4-25,53H,1-3H3 |
| InChIKey | ZGZQWPLJZWYXIO-UHFFFAOYSA-N |
| XLogP | 12.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.72 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|