C7H11N3O3S2 — CID 126541127
1,3-bis(2-sulfanylethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 126541127) has the molecular formula C7H11N3O3S2 and a molecular weight of 249.32 g/mol. Its IUPAC name is 1,3-bis(2-sulfanylethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis(2-sulfanylethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126541127 |
| Molecular Formula | C7H11N3O3S2 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 1,3-bis(2-sulfanylethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1[nH]c(=O)n(CCS)c(=O)n1CCS |
| InChI | InChI=1S/C7H11N3O3S2/c11-5-8-6(12)10(2-4-15)7(13)9(5)1-3-14/h14-15H,1-4H2,(H,8,11,12) |
| InChIKey | VNKAKBNSCZFJSL-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|