C26H44O4S — CID 126541901
(2R,3R,4S,5R,6S)-3,4,5-tributoxy-2-ethyl-6-(4-methylphenyl)sulfanyloxane (PubChem CID 126541901) has the molecular formula C26H44O4S and a molecular weight of 452.70 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-3,4,5-tributoxy-2-ethyl-6-(4-methylphenyl)sulfanyloxane.
| Compound Name | (2R,3R,4S,5R,6S)-3,4,5-tributoxy-2-ethyl-6-(4-methylphenyl)sulfanyloxane |
|---|---|
| PubChem CID | 126541901 |
| Molecular Formula | C26H44O4S |
| Molecular Weight | 452.70 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | (2R,3R,4S,5R,6S)-3,4,5-tributoxy-2-ethyl-6-(4-methylphenyl)sulfanyloxane |
| SMILES | CCCCO[C@@H]1[C@@H](OCCCC)[C@H](Sc2ccc(C)cc2)O[C@H](CC)[C@H]1OCCCC |
| InChI | InChI=1S/C26H44O4S/c1-6-10-17-27-23-22(9-4)30-26(31-21-15-13-20(5)14-16-21)25(29-19-12-8-3)24(23)28-18-11-7-2/h13-16,22-26H,6-12,17-19H2,1-5H3/t22-,23-,24+,25-,26+/m1/s1 |
| InChIKey | HHYNYYRMLAFBER-RTJMFUJLSA-N |
| XLogP | 6.78 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.70 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|