C15H27N3O — CID 126541910
[(4R,5S,6S)-10-pentyl-10,11,12-triazatricyclo[7.3.0.04,6]dodec-1(9)-en-5-yl]methanol (PubChem CID 126541910) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is [(4R,5S,6S)-10-pentyl-10,11,12-triazatricyclo[7.3.0.04,6]dodec-1(9)-en-5-yl]methanol.
| Compound Name | [(4R,5S,6S)-10-pentyl-10,11,12-triazatricyclo[7.3.0.04,6]dodec-1(9)-en-5-yl]methanol |
|---|---|
| PubChem CID | 126541910 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | [(4R,5S,6S)-10-pentyl-10,11,12-triazatricyclo[7.3.0.04,6]dodec-1(9)-en-5-yl]methanol |
| SMILES | CCCCCN1NNC2=C1CC[C@@H]1[C@@H](CO)[C@@H]1CC2 |
| InChI | InChI=1S/C15H27N3O/c1-2-3-4-9-18-15-8-6-12-11(13(12)10-19)5-7-14(15)16-17-18/h11-13,16-17,19H,2-10H2,1H3/t11-,12+,13+/m1/s1 |
| InChIKey | DMTIBBCXHCMXAV-AGIUHOORSA-N |
| XLogP | 2.14 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|