C14H27N3O — CID 126541912
[(1R,4Z,8S,9S)-4-amino-5-[amino(butyl)amino]-9-bicyclo[6.1.0]non-4-enyl]methanol (PubChem CID 126541912) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is [(1R,4Z,8S,9S)-4-amino-5-[amino(butyl)amino]-9-bicyclo[6.1.0]non-4-enyl]methanol.
| Compound Name | [(1R,4Z,8S,9S)-4-amino-5-[amino(butyl)amino]-9-bicyclo[6.1.0]non-4-enyl]methanol |
|---|---|
| PubChem CID | 126541912 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | [(1R,4Z,8S,9S)-4-amino-5-[amino(butyl)amino]-9-bicyclo[6.1.0]non-4-enyl]methanol |
| SMILES | CCCCN(N)/C1=C(\N)CC[C@H]2[C@H](CO)[C@H]2CC1 |
| InChI | InChI=1S/C14H27N3O/c1-2-3-8-17(16)14-7-5-11-10(12(11)9-18)4-6-13(14)15/h10-12,18H,2-9,15-16H2,1H3/b14-13-/t10-,11+,12+/m1/s1 |
| InChIKey | YLYHTTBZPNKQSF-KTURUGRZSA-N |
| XLogP | 1.56 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|