About 5,8,8-trimethyl-1,5-oxazonane
5,8,8-trimethyl-1,5-oxazonane (PubChem CID 126542335) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is 5,8,8-trimethyl-1,5-oxazonane.
Molecular Properties
| Compound Name | 5,8,8-trimethyl-1,5-oxazonane |
| PubChem CID | 126542335 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | 5,8,8-trimethyl-1,5-oxazonane |
| SMILES | CN1CCCOCC(C)(C)CC1 |
| InChI | InChI=1S/C10H21NO/c1-10(2)5-7-11(3)6-4-8-12-9-10/h4-9H2,1-3H3 |
| InChIKey | HOFUMAGBWBEKGS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,8,8-trimethyl-1,5-oxazonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8,8-trimethyl-1,5-oxazonane?
The IUPAC name of 5,8,8-trimethyl-1,5-oxazonane (CID 126542335) is 5,8,8-trimethyl-1,5-oxazonane.
What is the SMILES notation for 5,8,8-trimethyl-1,5-oxazonane?
The canonical SMILES for 5,8,8-trimethyl-1,5-oxazonane is CN1CCCOCC(C)(C)CC1.
What is the InChIKey of 5,8,8-trimethyl-1,5-oxazonane?
The InChIKey is HOFUMAGBWBEKGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO/c1-10(2)5-7-11(3)6-4-8-12-9-10/h4-9H2,1-3H3.
What are the key properties of 5,8,8-trimethyl-1,5-oxazonane?
5,8,8-trimethyl-1,5-oxazonane has a molecular weight of 171.28 g/mol, XLogP of 1.75, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8,8-trimethyl-1,5-oxazonane is sourced from PubChem (CID 126542335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).