C48H52N8+2 — CID 126542346
10-[4-[8-[4-(3,7-diamino-2,8-dimethylphenazin-5-ium-5-yl)phenyl]octyl]phenyl]-3,7-dimethylphenazin-10-ium-2,8-diamine (PubChem CID 126542346) has the molecular formula C48H52N8+2 and a molecular weight of 741.00 g/mol. Its IUPAC name is 10-[4-[8-[4-(3,7-diamino-2,8-dimethylphenazin-5-ium-5-yl)phenyl]octyl]phenyl]-3,7-dimethylphenazin-10-ium-2,8-diamine.
| Compound Name | 10-[4-[8-[4-(3,7-diamino-2,8-dimethylphenazin-5-ium-5-yl)phenyl]octyl]phenyl]-3,7-dimethylphenazin-10-ium-2,8-diamine |
|---|---|
| PubChem CID | 126542346 |
| Molecular Formula | C48H52N8+2 |
| Molecular Weight | 741.00 g/mol |
| Exact Mass | 740.43 |
| IUPAC Name | 10-[4-[8-[4-(3,7-diamino-2,8-dimethylphenazin-5-ium-5-yl)phenyl]octyl]phenyl]-3,7-dimethylphenazin-10-ium-2,8-diamine |
| SMILES | Cc1cc2nc3cc(C)c(N)cc3[n+](-c3ccc(CCCCCCCCc4ccc(-[n+]5c6cc(N)c(C)cc6nc6cc(C)c(N)cc65)cc4)cc3)c2cc1N |
| InChI | InChI=1S/C48H50N8/c1-29-21-41-45(25-37(29)49)55(46-26-38(50)30(2)22-42(46)53-41)35-17-13-33(14-18-35)11-9-7-5-6-8-10-12-34-15-19-36(20-16-34)56-47-27-39(51)31(3)23-43(47)54-44-24-32(4)40(52)28-48(44)56/h13-28H,5-12H2,1-4H3,(H6,49,50,51,52)/p+2 |
| InChIKey | XTQVWAUAQGAFIZ-UHFFFAOYSA-P |
| XLogP | 9.33 |
| TPSA | 137.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.00 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|