C23H26F2N4O4 — CID 126542512
(5S)-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-3,5-dimethyl-8,11-dioxo-4-propan-2-yl-1,4,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide (PubChem CID 126542512) has the molecular formula C23H26F2N4O4 and a molecular weight of 460.48 g/mol. Its IUPAC name is (5S)-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-3,5-dimethyl-8,11-dioxo-4-propan-2-yl-1,4,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide.
| Compound Name | (5S)-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-3,5-dimethyl-8,11-dioxo-4-propan-2-yl-1,4,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
|---|---|
| PubChem CID | 126542512 |
| Molecular Formula | C23H26F2N4O4 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | (5S)-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-3,5-dimethyl-8,11-dioxo-4-propan-2-yl-1,4,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
| SMILES | CC(C)N1[C@@H](C)CN2C(=O)c3c(O)c(=O)c(C(=O)NCc4ccc(F)cc4F)cn3CC21C |
| InChI | InChI=1S/C23H26F2N4O4/c1-12(2)29-13(3)9-28-22(33)18-20(31)19(30)16(10-27(18)11-23(28,29)4)21(32)26-8-14-5-6-15(24)7-17(14)25/h5-7,10,12-13,31H,8-9,11H2,1-4H3,(H,26,32)/t13-,23?/m0/s1 |
| InChIKey | YHDNJWXSOJUCJG-AVEISGIFSA-N |
| XLogP | 2.05 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |