C15H29N3O — CID 126542513
[(4Z,9S)-4-amino-5-[amino(2,2-dimethylpropyl)amino]-9-bicyclo[6.1.0]non-4-enyl]methanol (PubChem CID 126542513) has the molecular formula C15H29N3O and a molecular weight of 267.42 g/mol. Its IUPAC name is [(4Z,9S)-4-amino-5-[amino(2,2-dimethylpropyl)amino]-9-bicyclo[6.1.0]non-4-enyl]methanol.
| Compound Name | [(4Z,9S)-4-amino-5-[amino(2,2-dimethylpropyl)amino]-9-bicyclo[6.1.0]non-4-enyl]methanol |
|---|---|
| PubChem CID | 126542513 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | [(4Z,9S)-4-amino-5-[amino(2,2-dimethylpropyl)amino]-9-bicyclo[6.1.0]non-4-enyl]methanol |
| SMILES | CC(C)(C)CN(N)/C1=C(\N)CCC2C(CC1)[C@H]2CO |
| InChI | InChI=1S/C15H29N3O/c1-15(2,3)9-18(17)14-7-5-11-10(12(11)8-19)4-6-13(14)16/h10-12,19H,4-9,16-17H2,1-3H3/b14-13-/t10?,11?,12-/m0/s1 |
| InChIKey | PZZIRDBSDJGOJS-XLTYMOOCSA-N |
| XLogP | 1.81 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|