C42H24N6 — CID 126542641
2-[4-[3,5-bis[4-(5-cyano-3-pyridinyl)phenyl]phenyl]phenyl]pyridine-4-carbonitrile (PubChem CID 126542641) has the molecular formula C42H24N6 and a molecular weight of 612.70 g/mol. Its IUPAC name is 2-[4-[3,5-bis[4-(5-cyano-3-pyridinyl)phenyl]phenyl]phenyl]pyridine-4-carbonitrile.
| Compound Name | 2-[4-[3,5-bis[4-(5-cyano-3-pyridinyl)phenyl]phenyl]phenyl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 126542641 |
| Molecular Formula | C42H24N6 |
| Molecular Weight | 612.70 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | 2-[4-[3,5-bis[4-(5-cyano-3-pyridinyl)phenyl]phenyl]phenyl]pyridine-4-carbonitrile |
| SMILES | N#Cc1cncc(-c2ccc(-c3cc(-c4ccc(-c5cncc(C#N)c5)cc4)cc(-c4ccc(-c5cc(C#N)ccn5)cc4)c3)cc2)c1 |
| InChI | InChI=1S/C42H24N6/c43-21-28-13-14-48-42(17-28)36-11-9-33(10-12-36)39-19-37(31-1-5-34(6-2-31)40-15-29(22-44)24-46-26-40)18-38(20-39)32-3-7-35(8-4-32)41-16-30(23-45)25-47-27-41/h1-20,24-27H |
| InChIKey | PNKXIWFCSKLOPD-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 110.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.70 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |