3-iodo-1,5-dimethylpyrazole-4-carboxylic acid

C6H7IN2O2 — CID 12654288

IUPAC3-iodo-1,5-dimethylpyrazole-4-carboxylic acid
SMILESCc1c(C(=O)O)c(I)nn1C
InChIInChI=1S/C6H7IN2O2/c1-3-4(6(10)11)5(7)8-9(3)2/h1-2H3,(H,10,11)
InChIKeyUOHUWWTYXLSXHU-UHFFFAOYSA-N
MW266.04 g/mol
LogP1.03
Rot. Bonds1

About 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid

3-iodo-1,5-dimethylpyrazole-4-carboxylic acid (PubChem CID 12654288) has the molecular formula C6H7IN2O2 and a molecular weight of 266.04 g/mol. Its IUPAC name is 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid.

Molecular Properties

Compound Name3-iodo-1,5-dimethylpyrazole-4-carboxylic acid
PubChem CID12654288
Molecular FormulaC6H7IN2O2
Molecular Weight266.04 g/mol
Exact Mass265.96
IUPAC Name3-iodo-1,5-dimethylpyrazole-4-carboxylic acid
SMILESCc1c(C(=O)O)c(I)nn1C
InChIInChI=1S/C6H7IN2O2/c1-3-4(6(10)11)5(7)8-9(3)2/h1-2H3,(H,10,11)
InChIKeyUOHUWWTYXLSXHU-UHFFFAOYSA-N
XLogP1.03
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.04
LogP ≤ 51.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid?
The IUPAC name of 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid (CID 12654288) is 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid.
What is the SMILES notation for 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid?
The canonical SMILES for 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid is Cc1c(C(=O)O)c(I)nn1C.
What is the InChIKey of 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid?
The InChIKey is UOHUWWTYXLSXHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7IN2O2/c1-3-4(6(10)11)5(7)8-9(3)2/h1-2H3,(H,10,11).
What are the key properties of 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid?
3-iodo-1,5-dimethylpyrazole-4-carboxylic acid has a molecular weight of 266.04 g/mol, XLogP of 1.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid is sourced from PubChem (CID 12654288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).