About 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid
3-iodo-1,5-dimethylpyrazole-4-carboxylic acid (PubChem CID 12654288) has the molecular formula C6H7IN2O2
and a molecular weight of 266.04 g/mol. Its IUPAC name is 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid |
| PubChem CID | 12654288 |
| Molecular Formula | C6H7IN2O2 |
| Molecular Weight | 266.04 g/mol |
| Exact Mass | 265.96 |
| IUPAC Name | 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid |
| SMILES | Cc1c(C(=O)O)c(I)nn1C |
| InChI | InChI=1S/C6H7IN2O2/c1-3-4(6(10)11)5(7)8-9(3)2/h1-2H3,(H,10,11) |
| InChIKey | UOHUWWTYXLSXHU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.04 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid?
The IUPAC name of 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid (CID 12654288) is 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid.
What is the SMILES notation for 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid?
The canonical SMILES for 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid is Cc1c(C(=O)O)c(I)nn1C.
What is the InChIKey of 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid?
The InChIKey is UOHUWWTYXLSXHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7IN2O2/c1-3-4(6(10)11)5(7)8-9(3)2/h1-2H3,(H,10,11).
What are the key properties of 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid?
3-iodo-1,5-dimethylpyrazole-4-carboxylic acid has a molecular weight of 266.04 g/mol, XLogP of 1.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-1,5-dimethylpyrazole-4-carboxylic acid is sourced from PubChem (CID 12654288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).