C10H14N2 — CID 126543079
(3Z,5Z)-N-methyl-4-(methylideneamino)octa-1,3,5,7-tetraen-3-amine (PubChem CID 126543079) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (3Z,5Z)-N-methyl-4-(methylideneamino)octa-1,3,5,7-tetraen-3-amine.
| Compound Name | (3Z,5Z)-N-methyl-4-(methylideneamino)octa-1,3,5,7-tetraen-3-amine |
|---|---|
| PubChem CID | 126543079 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (3Z,5Z)-N-methyl-4-(methylideneamino)octa-1,3,5,7-tetraen-3-amine |
| SMILES | C=C/C=C\C(N=C)=C(/C=C)NC |
| InChI | InChI=1S/C10H14N2/c1-5-7-8-10(12-4)9(6-2)11-3/h5-8,11H,1-2,4H2,3H3/b8-7-,10-9- |
| InChIKey | IEUXLDUJPOBITE-QRLRYFCNSA-N |
| XLogP | 2.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|