C23H35N — CID 126543493
N-methyl-1-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanimine (PubChem CID 126543493) has the molecular formula C23H35N and a molecular weight of 325.54 g/mol. Its IUPAC name is N-methyl-1-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanimine.
| Compound Name | N-methyl-1-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanimine |
|---|---|
| PubChem CID | 126543493 |
| Molecular Formula | C23H35N |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | N-methyl-1-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)ethanimine |
| SMILES | C/N=C(\C)C1=CCC2C3CC=C4CC(C)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C23H35N/c1-15-10-12-22(3)17(14-15)6-7-18-20-9-8-19(16(2)24-5)23(20,4)13-11-21(18)22/h6,8,15,18,20-21H,7,9-14H2,1-5H3/b24-16+ |
| InChIKey | OFQYBAKHLJVNNB-LFVJCYFKSA-N |
| XLogP | 6.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|