C32H39N7O6 — CID 126543685
[2-[4-[[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]-methylamino]anilino]-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methyl pentanoate (PubChem CID 126543685) has the molecular formula C32H39N7O6 and a molecular weight of 617.71 g/mol. Its IUPAC name is [2-[4-[[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]-methylamino]anilino]-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methyl pentanoate.
| Compound Name | [2-[4-[[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]-methylamino]anilino]-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methyl pentanoate |
|---|---|
| PubChem CID | 126543685 |
| Molecular Formula | C32H39N7O6 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.30 |
| IUPAC Name | [2-[4-[[(3S)-1-(2-methoxyethyl)pyrrolidin-3-yl]-methylamino]anilino]-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methyl pentanoate |
| SMILES | CCCCC(=O)OCn1ccc2c(Oc3cccc([N+](=O)[O-])c3)nc(Nc3ccc(N(C)[C@H]4CCN(CCOC)C4)cc3)nc21 |
| InChI | InChI=1S/C32H39N7O6/c1-4-5-9-29(40)44-22-38-17-15-28-30(38)34-32(35-31(28)45-27-8-6-7-25(20-27)39(41)42)33-23-10-12-24(13-11-23)36(2)26-14-16-37(21-26)18-19-43-3/h6-8,10-13,15,17,20,26H,4-5,9,14,16,18-19,21-22H2,1-3H3,(H,33,34,35)/t26-/m0/s1 |
| InChIKey | XOGMDUIXDXQOEO-SANMLTNESA-N |
| XLogP | 5.72 |
| TPSA | 137.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|