C55H37N5O — CID 126543784
5-[4-[4-(4-carbazol-9-ylphenyl)-6-(9,9-dimethylfluoren-4-yl)-1,3,5-triazin-2-yl]phenyl]phenanthridin-6-one (PubChem CID 126543784) has the molecular formula C55H37N5O and a molecular weight of 783.94 g/mol. Its IUPAC name is 5-[4-[4-(4-carbazol-9-ylphenyl)-6-(9,9-dimethylfluoren-4-yl)-1,3,5-triazin-2-yl]phenyl]phenanthridin-6-one.
| Compound Name | 5-[4-[4-(4-carbazol-9-ylphenyl)-6-(9,9-dimethylfluoren-4-yl)-1,3,5-triazin-2-yl]phenyl]phenanthridin-6-one |
|---|---|
| PubChem CID | 126543784 |
| Molecular Formula | C55H37N5O |
| Molecular Weight | 783.94 g/mol |
| Exact Mass | 783.30 |
| IUPAC Name | 5-[4-[4-(4-carbazol-9-ylphenyl)-6-(9,9-dimethylfluoren-4-yl)-1,3,5-triazin-2-yl]phenyl]phenanthridin-6-one |
| SMILES | CC1(C)c2ccccc2-c2c(-c3nc(-c4ccc(-n5c(=O)c6ccccc6c6ccccc65)cc4)nc(-c4ccc(-n5c6ccccc6c6ccccc65)cc4)n3)cccc21 |
| InChI | InChI=1S/C55H37N5O/c1-55(2)45-21-9-5-19-43(45)50-44(20-13-22-46(50)55)53-57-51(34-26-30-36(31-27-34)59-47-23-10-7-16-40(47)41-17-8-11-24-48(41)59)56-52(58-53)35-28-32-37(33-29-35)60-49-25-12-6-15-39(49)38-14-3-4-18-42(38)54(60)61/h3-33H,1-2H3 |
| InChIKey | MWGBNVPBIMMQNW-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.94 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|