C53H31F6N7O — CID 126544044
[[6-(1H-indazol-3-yl)naphthalen-2-yl]methylamino]-[2-[5,6,7-trifluoro-1-(5,6,7-trifluoro-3-quinolin-2-ylindol-1-yl)indol-3-yl]quinolin-5-yl]methanol (PubChem CID 126544044) has the molecular formula C53H31F6N7O and a molecular weight of 895.87 g/mol. Its IUPAC name is [[6-(1H-indazol-3-yl)naphthalen-2-yl]methylamino]-[2-[5,6,7-trifluoro-1-(5,6,7-trifluoro-3-quinolin-2-ylindol-1-yl)indol-3-yl]quinolin-5-yl]methanol.
| Compound Name | [[6-(1H-indazol-3-yl)naphthalen-2-yl]methylamino]-[2-[5,6,7-trifluoro-1-(5,6,7-trifluoro-3-quinolin-2-ylindol-1-yl)indol-3-yl]quinolin-5-yl]methanol |
|---|---|
| PubChem CID | 126544044 |
| Molecular Formula | C53H31F6N7O |
| Molecular Weight | 895.87 g/mol |
| Exact Mass | 895.25 |
| IUPAC Name | [[6-(1H-indazol-3-yl)naphthalen-2-yl]methylamino]-[2-[5,6,7-trifluoro-1-(5,6,7-trifluoro-3-quinolin-2-ylindol-1-yl)indol-3-yl]quinolin-5-yl]methanol |
| SMILES | OC(NCc1ccc2cc(-c3n[nH]c4ccccc34)ccc2c1)c1cccc2nc(-c3cn(-n4cc(-c5ccc6ccccc6n5)c5cc(F)c(F)c(F)c54)c4c(F)c(F)c(F)cc34)ccc12 |
| InChI | InChI=1S/C53H31F6N7O/c54-39-22-35-37(43-18-16-28-6-1-3-9-41(28)61-43)25-65(51(35)48(58)46(39)56)66-26-38(36-23-40(55)47(57)49(59)52(36)66)44-19-17-32-33(8-5-11-42(32)62-44)53(67)60-24-27-12-13-30-21-31(15-14-29(30)20-27)50-34-7-2-4-10-45(34)63-64-50/h1-23,25-26,53,60,67H,24H2,(H,63,64) |
| InChIKey | FPAQSQYVJNJCQQ-UHFFFAOYSA-N |
| XLogP | 12.65 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.87 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|