C35H19ClF4N4 — CID 126544188
4-[3-(8-chloroquinolin-2-yl)-5,6,7-trifluoroindol-1-yl]-7-fluoro-2-(7-methyl-1H-indol-3-yl)quinoline (PubChem CID 126544188) has the molecular formula C35H19ClF4N4 and a molecular weight of 607.01 g/mol. Its IUPAC name is 4-[3-(8-chloroquinolin-2-yl)-5,6,7-trifluoroindol-1-yl]-7-fluoro-2-(7-methyl-1H-indol-3-yl)quinoline.
| Compound Name | 4-[3-(8-chloroquinolin-2-yl)-5,6,7-trifluoroindol-1-yl]-7-fluoro-2-(7-methyl-1H-indol-3-yl)quinoline |
|---|---|
| PubChem CID | 126544188 |
| Molecular Formula | C35H19ClF4N4 |
| Molecular Weight | 607.01 g/mol |
| Exact Mass | 606.12 |
| IUPAC Name | 4-[3-(8-chloroquinolin-2-yl)-5,6,7-trifluoroindol-1-yl]-7-fluoro-2-(7-methyl-1H-indol-3-yl)quinoline |
| SMILES | Cc1cccc2c(-c3cc(-n4cc(-c5ccc6cccc(Cl)c6n5)c5cc(F)c(F)c(F)c54)c4ccc(F)cc4n3)c[nH]c12 |
| InChI | InChI=1S/C35H19ClF4N4/c1-17-4-2-6-20-23(15-41-33(17)20)29-14-30(21-10-9-19(37)12-28(21)42-29)44-16-24(22-13-26(38)31(39)32(40)35(22)44)27-11-8-18-5-3-7-25(36)34(18)43-27/h2-16,41H,1H3 |
| InChIKey | KYLWTDOKBAJMBU-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.01 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|