C28H24F4N6O3 — CID 126544692
3-[4-[2-(2,3-dihydropyrazolo[5,1-b][1,3]oxazol-7-ylamino)pyrimidin-5-yl]-2-fluorophenyl]-1-imino-1-[2-methylidene-6-(1,1,1-trifluoro-2-methylpropan-2-yl)pyran-4-yl]propan-2-one (PubChem CID 126544692) has the molecular formula C28H24F4N6O3 and a molecular weight of 568.53 g/mol. Its IUPAC name is 3-[4-[2-(2,3-dihydropyrazolo[5,1-b][1,3]oxazol-7-ylamino)pyrimidin-5-yl]-2-fluorophenyl]-1-imino-1-[2-methylidene-6-(1,1,1-trifluoro-2-methylpropan-2-yl)pyran-4-yl]propan-2-one.
| Compound Name | 3-[4-[2-(2,3-dihydropyrazolo[5,1-b][1,3]oxazol-7-ylamino)pyrimidin-5-yl]-2-fluorophenyl]-1-imino-1-[2-methylidene-6-(1,1,1-trifluoro-2-methylpropan-2-yl)pyran-4-yl]propan-2-one |
|---|---|
| PubChem CID | 126544692 |
| Molecular Formula | C28H24F4N6O3 |
| Molecular Weight | 568.53 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | 3-[4-[2-(2,3-dihydropyrazolo[5,1-b][1,3]oxazol-7-ylamino)pyrimidin-5-yl]-2-fluorophenyl]-1-imino-1-[2-methylidene-6-(1,1,1-trifluoro-2-methylpropan-2-yl)pyran-4-yl]propan-2-one |
| SMILES | [H]/N=C(/C(=O)Cc1ccc(-c2cnc(Nc3cnn4c3OCC4)nc2)cc1F)C1=CC(=C)OC(C(C)(C)C(F)(F)F)=C1 |
| InChI | InChI=1S/C28H24F4N6O3/c1-15-8-18(11-23(41-15)27(2,3)28(30,31)32)24(33)22(39)10-17-5-4-16(9-20(17)29)19-12-34-26(35-13-19)37-21-14-36-38-6-7-40-25(21)38/h4-5,8-9,11-14,33H,1,6-7,10H2,2-3H3,(H,34,35,37)/b33-24+ |
| InChIKey | XOXIUPJRCKBVBB-IWBSIUBASA-N |
| XLogP | 5.69 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|