About 3-(hydroxyamino)propane-1,1,2,3-tetrol
3-(hydroxyamino)propane-1,1,2,3-tetrol (PubChem CID 126544770) has the molecular formula C3H9NO5
and a molecular weight of 139.11 g/mol. Its IUPAC name is 3-(hydroxyamino)propane-1,1,2,3-tetrol.
Molecular Properties
| Compound Name | 3-(hydroxyamino)propane-1,1,2,3-tetrol |
| PubChem CID | 126544770 |
| Molecular Formula | C3H9NO5 |
| Molecular Weight | 139.11 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 3-(hydroxyamino)propane-1,1,2,3-tetrol |
| SMILES | ONC(O)C(O)C(O)O |
| InChI | InChI=1S/C3H9NO5/c5-1(3(7)8)2(6)4-9/h1-9H |
| InChIKey | KHTYRKMJBUOCBA-UHFFFAOYSA-N |
| XLogP | -3.04 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 139.11 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(hydroxyamino)propane-1,1,2,3-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hydroxyamino)propane-1,1,2,3-tetrol?
The IUPAC name of 3-(hydroxyamino)propane-1,1,2,3-tetrol (CID 126544770) is 3-(hydroxyamino)propane-1,1,2,3-tetrol.
What is the SMILES notation for 3-(hydroxyamino)propane-1,1,2,3-tetrol?
The canonical SMILES for 3-(hydroxyamino)propane-1,1,2,3-tetrol is ONC(O)C(O)C(O)O.
What is the InChIKey of 3-(hydroxyamino)propane-1,1,2,3-tetrol?
The InChIKey is KHTYRKMJBUOCBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NO5/c5-1(3(7)8)2(6)4-9/h1-9H.
What are the key properties of 3-(hydroxyamino)propane-1,1,2,3-tetrol?
3-(hydroxyamino)propane-1,1,2,3-tetrol has a molecular weight of 139.11 g/mol, XLogP of -3.04, 3 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hydroxyamino)propane-1,1,2,3-tetrol is sourced from PubChem (CID 126544770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).