About 3-(bromomethyl)-4-(4,4,4-trifluorobutyl)isoquinoline
3-(bromomethyl)-4-(4,4,4-trifluorobutyl)isoquinoline (PubChem CID 126544815) has the molecular formula C14H13BrF3N
and a molecular weight of 332.16 g/mol. Its IUPAC name is 3-(bromomethyl)-4-(4,4,4-trifluorobutyl)isoquinoline.
Molecular Properties
| Compound Name | 3-(bromomethyl)-4-(4,4,4-trifluorobutyl)isoquinoline |
| PubChem CID | 126544815 |
| Molecular Formula | C14H13BrF3N |
| Molecular Weight | 332.16 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 3-(bromomethyl)-4-(4,4,4-trifluorobutyl)isoquinoline |
| SMILES | FC(F)(F)CCCc1c(CBr)ncc2ccccc12 |
| InChI | InChI=1S/C14H13BrF3N/c15-8-13-12(6-3-7-14(16,17)18)11-5-2-1-4-10(11)9-19-13/h1-2,4-5,9H,3,6-8H2 |
| InChIKey | FAKHFAZIPBBWNZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.16 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(bromomethyl)-4-(4,4,4-trifluorobutyl)isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(bromomethyl)-4-(4,4,4-trifluorobutyl)isoquinoline?
The IUPAC name of 3-(bromomethyl)-4-(4,4,4-trifluorobutyl)isoquinoline (CID 126544815) is 3-(bromomethyl)-4-(4,4,4-trifluorobutyl)isoquinoline.
What is the SMILES notation for 3-(bromomethyl)-4-(4,4,4-trifluorobutyl)isoquinoline?
The canonical SMILES for 3-(bromomethyl)-4-(4,4,4-trifluorobutyl)isoquinoline is FC(F)(F)CCCc1c(CBr)ncc2ccccc12.
What is the InChIKey of 3-(bromomethyl)-4-(4,4,4-trifluorobutyl)isoquinoline?
The InChIKey is FAKHFAZIPBBWNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrF3N/c15-8-13-12(6-3-7-14(16,17)18)11-5-2-1-4-10(11)9-19-13/h1-2,4-5,9H,3,6-8H2.
What are the key properties of 3-(bromomethyl)-4-(4,4,4-trifluorobutyl)isoquinoline?
3-(bromomethyl)-4-(4,4,4-trifluorobutyl)isoquinoline has a molecular weight of 332.16 g/mol, XLogP of 5.01, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(bromomethyl)-4-(4,4,4-trifluorobutyl)isoquinoline is sourced from PubChem (CID 126544815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).