C10H17N — CID 126544961
(2E,4Z)-N,2-diethylhexa-2,4-dien-1-imine (PubChem CID 126544961) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (2E,4Z)-N,2-diethylhexa-2,4-dien-1-imine.
| Compound Name | (2E,4Z)-N,2-diethylhexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 126544961 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (2E,4Z)-N,2-diethylhexa-2,4-dien-1-imine |
| SMILES | C/C=C\C=C(\C=N\CC)CC |
| InChI | InChI=1S/C10H17N/c1-4-7-8-10(5-2)9-11-6-3/h4,7-9H,5-6H2,1-3H3/b7-4-,10-8+,11-9+ |
| InChIKey | GFCAMCVTOXVLCO-KVNUYZLESA-N |
| XLogP | 2.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|