C28H32FN5O3 — CID 126544977
3-[[5-fluoro-4-(4-hydroxybutyl)isoquinolin-3-yl]methyl]-1-[1-(1-methoxyethenyl)piperidin-4-yl]imidazo[4,5-c]pyridin-2-one (PubChem CID 126544977) has the molecular formula C28H32FN5O3 and a molecular weight of 505.59 g/mol. Its IUPAC name is 3-[[5-fluoro-4-(4-hydroxybutyl)isoquinolin-3-yl]methyl]-1-[1-(1-methoxyethenyl)piperidin-4-yl]imidazo[4,5-c]pyridin-2-one.
| Compound Name | 3-[[5-fluoro-4-(4-hydroxybutyl)isoquinolin-3-yl]methyl]-1-[1-(1-methoxyethenyl)piperidin-4-yl]imidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 126544977 |
| Molecular Formula | C28H32FN5O3 |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 3-[[5-fluoro-4-(4-hydroxybutyl)isoquinolin-3-yl]methyl]-1-[1-(1-methoxyethenyl)piperidin-4-yl]imidazo[4,5-c]pyridin-2-one |
| SMILES | C=C(OC)N1CCC(n2c(=O)n(Cc3ncc4cccc(F)c4c3CCCCO)c3cnccc32)CC1 |
| InChI | InChI=1S/C28H32FN5O3/c1-19(37-2)32-13-10-21(11-14-32)34-25-9-12-30-17-26(25)33(28(34)36)18-24-22(7-3-4-15-35)27-20(16-31-24)6-5-8-23(27)29/h5-6,8-9,12,16-17,21,35H,1,3-4,7,10-11,13-15,18H2,2H3 |
| InChIKey | ZYEXNEUUSGTZPP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|