About 3-fluoro-3,4-dihydroisoquinoline
3-fluoro-3,4-dihydroisoquinoline (PubChem CID 126545017) has the molecular formula C9H8FN
and a molecular weight of 149.17 g/mol. Its IUPAC name is 3-fluoro-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 3-fluoro-3,4-dihydroisoquinoline |
| PubChem CID | 126545017 |
| Molecular Formula | C9H8FN |
| Molecular Weight | 149.17 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 3-fluoro-3,4-dihydroisoquinoline |
| SMILES | FC1Cc2ccccc2C=N1 |
| InChI | InChI=1S/C9H8FN/c10-9-5-7-3-1-2-4-8(7)6-11-9/h1-4,6,9H,5H2 |
| InChIKey | FEFDLWFJLODYGE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.17 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-3,4-dihydroisoquinoline?
The IUPAC name of 3-fluoro-3,4-dihydroisoquinoline (CID 126545017) is 3-fluoro-3,4-dihydroisoquinoline.
What is the SMILES notation for 3-fluoro-3,4-dihydroisoquinoline?
The canonical SMILES for 3-fluoro-3,4-dihydroisoquinoline is FC1Cc2ccccc2C=N1.
What is the InChIKey of 3-fluoro-3,4-dihydroisoquinoline?
The InChIKey is FEFDLWFJLODYGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FN/c10-9-5-7-3-1-2-4-8(7)6-11-9/h1-4,6,9H,5H2.
What are the key properties of 3-fluoro-3,4-dihydroisoquinoline?
3-fluoro-3,4-dihydroisoquinoline has a molecular weight of 149.17 g/mol, XLogP of 1.96, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-3,4-dihydroisoquinoline is sourced from PubChem (CID 126545017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).