C12H20N2 — CID 126545167
(6S)-6-propan-2-yl-4,5,6,7,8,9-hexahydro-3H-pyrido[4,3-b]azepine (PubChem CID 126545167) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (6S)-6-propan-2-yl-4,5,6,7,8,9-hexahydro-3H-pyrido[4,3-b]azepine.
| Compound Name | (6S)-6-propan-2-yl-4,5,6,7,8,9-hexahydro-3H-pyrido[4,3-b]azepine |
|---|---|
| PubChem CID | 126545167 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (6S)-6-propan-2-yl-4,5,6,7,8,9-hexahydro-3H-pyrido[4,3-b]azepine |
| SMILES | CC(C)[C@@H]1NCCC2=C1CCCC=N2 |
| InChI | InChI=1S/C12H20N2/c1-9(2)12-10-5-3-4-7-13-11(10)6-8-14-12/h7,9,12,14H,3-6,8H2,1-2H3/t12-/m0/s1 |
| InChIKey | BHXVJSDHMHXUFG-LBPRGKRZSA-N |
| XLogP | 2.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |