About (3-methyloxiran-2-yl) 2-cyanoprop-2-enoate
(3-methyloxiran-2-yl) 2-cyanoprop-2-enoate (PubChem CID 126545274) has the molecular formula C7H7NO3
and a molecular weight of 153.14 g/mol. Its IUPAC name is (3-methyloxiran-2-yl) 2-cyanoprop-2-enoate.
Molecular Properties
| Compound Name | (3-methyloxiran-2-yl) 2-cyanoprop-2-enoate |
| PubChem CID | 126545274 |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | (3-methyloxiran-2-yl) 2-cyanoprop-2-enoate |
| SMILES | C=C(C#N)C(=O)OC1OC1C |
| InChI | InChI=1S/C7H7NO3/c1-4(3-8)6(9)11-7-5(2)10-7/h5,7H,1H2,2H3 |
| InChIKey | JFEAQCWVMLXZPJ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (3-methyloxiran-2-yl) 2-cyanoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyloxiran-2-yl) 2-cyanoprop-2-enoate?
The IUPAC name of (3-methyloxiran-2-yl) 2-cyanoprop-2-enoate (CID 126545274) is (3-methyloxiran-2-yl) 2-cyanoprop-2-enoate.
What is the SMILES notation for (3-methyloxiran-2-yl) 2-cyanoprop-2-enoate?
The canonical SMILES for (3-methyloxiran-2-yl) 2-cyanoprop-2-enoate is C=C(C#N)C(=O)OC1OC1C.
What is the InChIKey of (3-methyloxiran-2-yl) 2-cyanoprop-2-enoate?
The InChIKey is JFEAQCWVMLXZPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3/c1-4(3-8)6(9)11-7-5(2)10-7/h5,7H,1H2,2H3.
What are the key properties of (3-methyloxiran-2-yl) 2-cyanoprop-2-enoate?
(3-methyloxiran-2-yl) 2-cyanoprop-2-enoate has a molecular weight of 153.14 g/mol, XLogP of 0.35, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyloxiran-2-yl) 2-cyanoprop-2-enoate is sourced from PubChem (CID 126545274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).