C21H23F3O2 — CID 126545405
(6R,7aR)-7a-[(2S)-1-(2,5-difluoro-4-methylphenyl)propan-2-yl]-6-(2-fluoroprop-2-enyl)-2,3,6,7-tetrahydro-1-benzofuran-5-one (PubChem CID 126545405) has the molecular formula C21H23F3O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is (6R,7aR)-7a-[(2S)-1-(2,5-difluoro-4-methylphenyl)propan-2-yl]-6-(2-fluoroprop-2-enyl)-2,3,6,7-tetrahydro-1-benzofuran-5-one.
| Compound Name | (6R,7aR)-7a-[(2S)-1-(2,5-difluoro-4-methylphenyl)propan-2-yl]-6-(2-fluoroprop-2-enyl)-2,3,6,7-tetrahydro-1-benzofuran-5-one |
|---|---|
| PubChem CID | 126545405 |
| Molecular Formula | C21H23F3O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (6R,7aR)-7a-[(2S)-1-(2,5-difluoro-4-methylphenyl)propan-2-yl]-6-(2-fluoroprop-2-enyl)-2,3,6,7-tetrahydro-1-benzofuran-5-one |
| SMILES | C=C(F)C[C@H]1C[C@]2(C(C)Cc3cc(F)c(C)cc3F)OCCC2=CC1=O |
| InChI | InChI=1S/C21H23F3O2/c1-12-6-19(24)15(9-18(12)23)7-13(2)21-11-16(8-14(3)22)20(25)10-17(21)4-5-26-21/h6,9-10,13,16H,3-5,7-8,11H2,1-2H3/t13?,16-,21+/m0/s1 |
| InChIKey | CHXAOTREGIHSHX-LXVSVZDUSA-N |
| XLogP | 5.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |