C21H24F2O3 — CID 126545519
(6R,7aS)-7a-[1-(2,5-difluoro-4-methoxyphenyl)propan-2-yl]-6-prop-2-enyl-2,3,6,7-tetrahydro-1-benzofuran-5-one (PubChem CID 126545519) has the molecular formula C21H24F2O3 and a molecular weight of 362.42 g/mol. Its IUPAC name is (6R,7aS)-7a-[1-(2,5-difluoro-4-methoxyphenyl)propan-2-yl]-6-prop-2-enyl-2,3,6,7-tetrahydro-1-benzofuran-5-one.
| Compound Name | (6R,7aS)-7a-[1-(2,5-difluoro-4-methoxyphenyl)propan-2-yl]-6-prop-2-enyl-2,3,6,7-tetrahydro-1-benzofuran-5-one |
|---|---|
| PubChem CID | 126545519 |
| Molecular Formula | C21H24F2O3 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (6R,7aS)-7a-[1-(2,5-difluoro-4-methoxyphenyl)propan-2-yl]-6-prop-2-enyl-2,3,6,7-tetrahydro-1-benzofuran-5-one |
| SMILES | C=CC[C@@H]1C[C@@]2(C(C)Cc3cc(F)c(OC)cc3F)OCCC2=CC1=O |
| InChI | InChI=1S/C21H24F2O3/c1-4-5-14-12-21(16(6-7-26-21)10-19(14)24)13(2)8-15-9-18(23)20(25-3)11-17(15)22/h4,9-11,13-14H,1,5-8,12H2,2-3H3/t13?,14-,21+/m1/s1 |
| InChIKey | PVRBLIAORRQNMB-NHLOTGQUSA-N |
| XLogP | 4.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|