C23H22N4O — CID 126545523
4-[1-(3-aminopropyl)indol-3-yl]-3-(1H-indol-3-yl)-1,2-dihydropyrrol-5-one (PubChem CID 126545523) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is 4-[1-(3-aminopropyl)indol-3-yl]-3-(1H-indol-3-yl)-1,2-dihydropyrrol-5-one.
| Compound Name | 4-[1-(3-aminopropyl)indol-3-yl]-3-(1H-indol-3-yl)-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 126545523 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 4-[1-(3-aminopropyl)indol-3-yl]-3-(1H-indol-3-yl)-1,2-dihydropyrrol-5-one |
| SMILES | NCCCn1cc(C2=C(c3c[nH]c4ccccc34)CNC2=O)c2ccccc21 |
| InChI | InChI=1S/C23H22N4O/c24-10-5-11-27-14-19(16-7-2-4-9-21(16)27)22-18(13-26-23(22)28)17-12-25-20-8-3-1-6-15(17)20/h1-4,6-9,12,14,25H,5,10-11,13,24H2,(H,26,28) |
| InChIKey | IEEXBUOYPJQQLX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |