About [(4Z,10S)-5-amino-4-[amino(tert-butyl)amino]-10-bicyclo[7.1.0]dec-4-enyl]methanol
[(4Z,10S)-5-amino-4-[amino(tert-butyl)amino]-10-bicyclo[7.1.0]dec-4-enyl]methanol (PubChem CID 126545547) has the molecular formula C15H29N3O
and a molecular weight of 267.42 g/mol. Its IUPAC name is [(4Z,10S)-5-amino-4-[amino(tert-butyl)amino]-10-bicyclo[7.1.0]dec-4-enyl]methanol.
Molecular Properties
| Compound Name | [(4Z,10S)-5-amino-4-[amino(tert-butyl)amino]-10-bicyclo[7.1.0]dec-4-enyl]methanol |
| PubChem CID | 126545547 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | [(4Z,10S)-5-amino-4-[amino(tert-butyl)amino]-10-bicyclo[7.1.0]dec-4-enyl]methanol |
| SMILES | CC(C)(C)N(N)/C1=C(\N)CCCC2C(CC1)[C@H]2CO |
| InChI | InChI=1S/C15H29N3O/c1-15(2,3)18(17)14-8-7-11-10(12(11)9-19)5-4-6-13(14)16/h10-12,19H,4-9,16-17H2,1-3H3/b14-13-/t10?,11?,12-/m0/s1 |
| InChIKey | QULUFSCRPFJFKN-XLTYMOOCSA-N |
| XLogP | 1.95 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4Z,10S)-5-amino-4-[amino(tert-butyl)amino]-10-bicyclo[7.1.0]dec-4-enyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4Z,10S)-5-amino-4-[amino(tert-butyl)amino]-10-bicyclo[7.1.0]dec-4-enyl]methanol?
The IUPAC name of [(4Z,10S)-5-amino-4-[amino(tert-butyl)amino]-10-bicyclo[7.1.0]dec-4-enyl]methanol (CID 126545547) is [(4Z,10S)-5-amino-4-[amino(tert-butyl)amino]-10-bicyclo[7.1.0]dec-4-enyl]methanol.
What is the SMILES notation for [(4Z,10S)-5-amino-4-[amino(tert-butyl)amino]-10-bicyclo[7.1.0]dec-4-enyl]methanol?
The canonical SMILES for [(4Z,10S)-5-amino-4-[amino(tert-butyl)amino]-10-bicyclo[7.1.0]dec-4-enyl]methanol is CC(C)(C)N(N)/C1=C(\N)CCCC2C(CC1)[C@H]2CO.
What is the InChIKey of [(4Z,10S)-5-amino-4-[amino(tert-butyl)amino]-10-bicyclo[7.1.0]dec-4-enyl]methanol?
The InChIKey is QULUFSCRPFJFKN-XLTYMOOCSA-N. The full InChI is InChI=1S/C15H29N3O/c1-15(2,3)18(17)14-8-7-11-10(12(11)9-19)5-4-6-13(14)16/h10-12,19H,4-9,16-17H2,1-3H3/b14-13-/t10?,11?,12-/m0/s1.
What are the key properties of [(4Z,10S)-5-amino-4-[amino(tert-butyl)amino]-10-bicyclo[7.1.0]dec-4-enyl]methanol?
[(4Z,10S)-5-amino-4-[amino(tert-butyl)amino]-10-bicyclo[7.1.0]dec-4-enyl]methanol has a molecular weight of 267.42 g/mol, XLogP of 1.95, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4Z,10S)-5-amino-4-[amino(tert-butyl)amino]-10-bicyclo[7.1.0]dec-4-enyl]methanol is sourced from PubChem (CID 126545547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).