C16H32N4O — CID 126545611
(1S,4Z,8R,9S)-5-[amino(2,2-dimethylpropyl)amino]-9-(methoxymethyl)bicyclo[6.1.0]non-4-ene-1,4-diamine (PubChem CID 126545611) has the molecular formula C16H32N4O and a molecular weight of 296.46 g/mol. Its IUPAC name is (1S,4Z,8R,9S)-5-[amino(2,2-dimethylpropyl)amino]-9-(methoxymethyl)bicyclo[6.1.0]non-4-ene-1,4-diamine.
| Compound Name | (1S,4Z,8R,9S)-5-[amino(2,2-dimethylpropyl)amino]-9-(methoxymethyl)bicyclo[6.1.0]non-4-ene-1,4-diamine |
|---|---|
| PubChem CID | 126545611 |
| Molecular Formula | C16H32N4O |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | (1S,4Z,8R,9S)-5-[amino(2,2-dimethylpropyl)amino]-9-(methoxymethyl)bicyclo[6.1.0]non-4-ene-1,4-diamine |
| SMILES | COC[C@H]1[C@H]2CC/C(N(N)CC(C)(C)C)=C(/N)CC[C@]21N |
| InChI | InChI=1S/C16H32N4O/c1-15(2,3)10-20(19)14-6-5-11-12(9-21-4)16(11,18)8-7-13(14)17/h11-12H,5-10,17-19H2,1-4H3/b14-13-/t11-,12+,16+/m1/s1 |
| InChIKey | BVBYGYOWWUBRFR-MFZQETABSA-N |
| XLogP | 1.54 |
| TPSA | 90.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|