C15H26N2O — CID 126546063
N-[(1E,3E)-4,5,5-trimethyl-1-(methylideneamino)hexa-1,3-dien-2-yl]oxan-4-amine (PubChem CID 126546063) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is N-[(1E,3E)-4,5,5-trimethyl-1-(methylideneamino)hexa-1,3-dien-2-yl]oxan-4-amine.
| Compound Name | N-[(1E,3E)-4,5,5-trimethyl-1-(methylideneamino)hexa-1,3-dien-2-yl]oxan-4-amine |
|---|---|
| PubChem CID | 126546063 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | N-[(1E,3E)-4,5,5-trimethyl-1-(methylideneamino)hexa-1,3-dien-2-yl]oxan-4-amine |
| SMILES | C=N/C=C(\C=C(/C)C(C)(C)C)NC1CCOCC1 |
| InChI | InChI=1S/C15H26N2O/c1-12(15(2,3)4)10-14(11-16-5)17-13-6-8-18-9-7-13/h10-11,13,17H,5-9H2,1-4H3/b12-10+,14-11+ |
| InChIKey | YBCZHWYCNMLWAP-NCPBJGSTSA-N |
| XLogP | 3.29 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|