C18H20N4O2 — CID 126546247
N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1,4-diazacyclohepta-2,4,5,7-tetraene-2-carboxamide (PubChem CID 126546247) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1,4-diazacyclohepta-2,4,5,7-tetraene-2-carboxamide.
| Compound Name | N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1,4-diazacyclohepta-2,4,5,7-tetraene-2-carboxamide |
|---|---|
| PubChem CID | 126546247 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1,4-diazacyclohepta-2,4,5,7-tetraene-2-carboxamide |
| SMILES | O=C(NC[C@H](O)CN1CCc2ccccc2C1)C1=CN=C=CC=N1 |
| InChI | InChI=1S/C18H20N4O2/c23-16(10-21-18(24)17-11-19-7-3-8-20-17)13-22-9-6-14-4-1-2-5-15(14)12-22/h1-5,8,11,16,23H,6,9-10,12-13H2,(H,21,24)/t16-/m0/s1 |
| InChIKey | QMKZVXAYFFYOLR-INIZCTEOSA-N |
| XLogP | 0.67 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |