C30H45N — CID 126546274
2,5,6-trimethyl-N-[(3E)-3-[[2-methyl-4-[(2Z)-penta-2,4-dienyl]-4-prop-1-en-2-ylcyclopenten-1-yl]methylidene]penta-1,4-dien-2-yl]hept-1-en-3-amine (PubChem CID 126546274) has the molecular formula C30H45N and a molecular weight of 419.70 g/mol. Its IUPAC name is 2,5,6-trimethyl-N-[(3E)-3-[[2-methyl-4-[(2Z)-penta-2,4-dienyl]-4-prop-1-en-2-ylcyclopenten-1-yl]methylidene]penta-1,4-dien-2-yl]hept-1-en-3-amine.
| Compound Name | 2,5,6-trimethyl-N-[(3E)-3-[[2-methyl-4-[(2Z)-penta-2,4-dienyl]-4-prop-1-en-2-ylcyclopenten-1-yl]methylidene]penta-1,4-dien-2-yl]hept-1-en-3-amine |
|---|---|
| PubChem CID | 126546274 |
| Molecular Formula | C30H45N |
| Molecular Weight | 419.70 g/mol |
| Exact Mass | 419.36 |
| IUPAC Name | 2,5,6-trimethyl-N-[(3E)-3-[[2-methyl-4-[(2Z)-penta-2,4-dienyl]-4-prop-1-en-2-ylcyclopenten-1-yl]methylidene]penta-1,4-dien-2-yl]hept-1-en-3-amine |
| SMILES | C=C/C=C\CC1(C(=C)C)CC(C)=C(/C=C(\C=C)C(=C)NC(CC(C)C(C)C)C(=C)C)C1 |
| InChI | InChI=1S/C30H45N/c1-12-14-15-16-30(23(7)8)19-25(10)28(20-30)18-27(13-2)26(11)31-29(22(5)6)17-24(9)21(3)4/h12-15,18,21,24,29,31H,1-2,5,7,11,16-17,19-20H2,3-4,6,8-10H3/b15-14-,27-18+ |
| InChIKey | WIOKVECOEKQNEN-NSMAEENOSA-N |
| XLogP | 8.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.70 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|